Type: Neutral
Formula: C18H24N2O5S
SMILES: |
S(=O)(=O)(NC(CC(=O)NCCCOC)c1occc1)c1ccc(cc1)C |
InChI: |
InChI=1/C18H24N2O5S/c1-14-6-8-15(9-7-14)26(22,23)20-16(17-5-3-12-25-17)13-18(21)19-10-4-11-24-2/h3,5-9,12,16,20H,4,10-11,13H2,1-2H3,(H,19,21)/t16-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 380.465 g/mol | logS: -3.61515 | SlogP: 2.24592 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0446505 | Sterimol/B1: 3.1877 | Sterimol/B2: 3.9752 | Sterimol/B3: 4.34235 |
Sterimol/B4: 5.69197 | Sterimol/L: 20.7829 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 644.939 | Positive charged surface: 446.036 | Negative charged surface: 198.903 | Volume: 354.375 |
Hydrophobic surface: 521.701 | Hydrophilic surface: 123.238 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |