Type: Neutral
Formula: C18H28N2O4S
SMILES: |
S(=O)(=O)(NCC(C)C)c1ccc(cc1)CCC(=O)NCC1OCCC1 |
InChI: |
InChI=1/C18H28N2O4S/c1-14(2)12-20-25(22,23)17-8-5-15(6-9-17)7-10-18(21)19-13-16-4-3-11-24-16/h5-6,8-9,14,16,20H,3-4,7,10-13H2,1-2H3,(H,19,21)/t16-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 368.498 g/mol | logS: -2.73815 | SlogP: 1.84867 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0320111 | Sterimol/B1: 1.969 | Sterimol/B2: 3.61901 | Sterimol/B3: 5.63323 |
Sterimol/B4: 5.67507 | Sterimol/L: 21.6556 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 677.081 | Positive charged surface: 458.949 | Negative charged surface: 218.132 | Volume: 355.625 |
Hydrophobic surface: 505.172 | Hydrophilic surface: 171.909 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |