 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1CC(O)C(O)C(O)C1OCCO\N=C/1\c2c(N\C\1=C\1/c3c(NC/1=O)cccc3)c ccc2 |
| InChI: | InChI=1/C23H23N3O7/c27-16-11-32-23(21(29)20(16)28)31-9-10-33-26-18-13-6-2-4-8-15(13)24-19(18)17-12-5-1-3-7-14(12)25-22(17)30/h1-8,16,20-21,23-24,27-29H,9-11H2,(H,25,30)/b19-17-,26-18+/t16-,20-,21-,23-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=176.858 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 453.451 g/mol | logS: -4.26966 | SlogP: 0.6518 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0334976 | Sterimol/B1: 2.87128 | Sterimol/B2: 3.16164 | Sterimol/B3: 3.99934 | |||
| Sterimol/B4: 11.061 | Sterimol/L: 18.5641 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 694.471 | Positive charged surface: 468.414 | Negative charged surface: 226.057 | Volume: 400.375 | |||
| Hydrophobic surface: 468.356 | Hydrophilic surface: 226.115 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules: no related molecules available.