 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(C)c1cc(ccc1)C(N1CC(N(CC1C)CC=C)C)c1ccc(cc1)C(=O)N1CCCCC1 |
| InChI: | InChI=1/C29H39N3O2/c1-5-16-31-20-23(3)32(21-22(31)2)28(26-10-9-11-27(19-26)34-4)24-12-14-25(15-13-24)29(33)30-17-7-6-8-18-30/h5,9-15,19,22-23,28H,1,6-8,16-18,20-21H2,2-4H3/t22-,23+,28+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=189.279 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 461.65 g/mol | logS: -5.06628 | SlogP: 5.0868 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0980483 | Sterimol/B1: 4.53907 | Sterimol/B2: 4.59645 | Sterimol/B3: 7.53301 | |||
| Sterimol/B4: 7.69932 | Sterimol/L: 19.5872 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 785.416 | Positive charged surface: 577.976 | Negative charged surface: 207.44 | Volume: 480.625 | |||
| Hydrophobic surface: 659.845 | Hydrophilic surface: 125.571 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 0 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules
