Type: Neutral
Formula: C13H18N6O5
SMILES: |
O1CC2OC(N3C=C(C)C(=O)NC3=O)CC2N(O)C1CCN=[N+]=[N-] |
InChI: |
InChI=1/C13H18N6O5/c1-7-5-18(13(21)16-12(7)20)11-4-8-9(24-11)6-23-10(19(8)22)2-3-15-17-14/h5,8-11,22H,2-4,6H2,1H3,(H,16,20,21)/t8-,9-,10-,11-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 338.324 g/mol | logS: -0.80842 | SlogP: 0.6735 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.100503 | Sterimol/B1: 3.73297 | Sterimol/B2: 4.47543 | Sterimol/B3: 4.60175 |
Sterimol/B4: 5.85703 | Sterimol/L: 15.257 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 538.073 | Positive charged surface: 341.607 | Negative charged surface: 196.466 | Volume: 287.25 |
Hydrophobic surface: 310.885 | Hydrophilic surface: 227.188 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |