Type: Neutral
Formula: C17H20N2O7
SMILES: |
O1C(CO)C(O)C(O)C1N1C=C(OCCc2ccccc2)C(=O)NC1=O |
InChI: |
InChI=1/C17H20N2O7/c20-9-12-13(21)14(22)16(26-12)19-8-11(15(23)18-17(19)24)25-7-6-10-4-2-1-3-5-10/h1-5,8,12-14,16,20-22H,6-7,9H2,(H,18,23,24)/t12-,13+,14-,16-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 364.354 g/mol | logS: -1.78743 | SlogP: -0.92213 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0821118 | Sterimol/B1: 3.54613 | Sterimol/B2: 3.81801 | Sterimol/B3: 3.88368 |
Sterimol/B4: 8.41014 | Sterimol/L: 14.8086 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 616.693 | Positive charged surface: 395.664 | Negative charged surface: 221.03 | Volume: 319.625 |
Hydrophobic surface: 359.586 | Hydrophilic surface: 257.107 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |