Type: Neutral
Formula: C19H22N2O6
SMILES: |
O1C(CO)C(O)CC1N1C=C(OC\C=C\Cc2ccccc2)C(=O)NC1=O |
InChI: |
InChI=1/C19H22N2O6/c22-12-16-14(23)10-17(27-16)21-11-15(18(24)20-19(21)25)26-9-5-4-8-13-6-2-1-3-7-13/h1-7,11,14,16-17,22-23H,8-10,12H2,(H,20,24,25)/b5-4+/t14-,16+,17+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 374.393 g/mol | logS: -3.01101 | SlogP: 0.66327 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0868535 | Sterimol/B1: 2.38978 | Sterimol/B2: 4.91841 | Sterimol/B3: 5.73785 |
Sterimol/B4: 7.02454 | Sterimol/L: 16.7924 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 662.935 | Positive charged surface: 432.213 | Negative charged surface: 230.723 | Volume: 345.5 |
Hydrophobic surface: 409.199 | Hydrophilic surface: 253.736 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |