Type: Neutral
Formula: C17H20N2O6
SMILES: |
O1C(CO)C(O)CC1N1C=C(OCCc2ccccc2)C(=O)NC1=O |
InChI: |
InChI=1/C17H20N2O6/c20-10-14-12(21)8-15(25-14)19-9-13(16(22)18-17(19)23)24-7-6-11-4-2-1-3-5-11/h1-5,9,12,14-15,20-21H,6-8,10H2,(H,18,22,23)/t12-,14-,15-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 348.355 g/mol | logS: -2.19174 | SlogP: 0.10707 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0912769 | Sterimol/B1: 3.54908 | Sterimol/B2: 3.80453 | Sterimol/B3: 3.94673 |
Sterimol/B4: 8.35011 | Sterimol/L: 14.015 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 609.606 | Positive charged surface: 397.772 | Negative charged surface: 211.833 | Volume: 313 |
Hydrophobic surface: 387.423 | Hydrophilic surface: 222.183 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |