Type: Neutral
Formula: C16H18N2O6
SMILES: |
O1C(CO)C(O)CC1N1C=C(OCc2ccccc2)C(=O)NC1=O |
InChI: |
InChI=1/C16H18N2O6/c19-8-13-11(20)6-14(24-13)18-7-12(15(21)17-16(18)22)23-9-10-4-2-1-3-5-10/h1-5,7,11,13-14,19-20H,6,8-9H2,(H,17,21,22)/t11-,13-,14-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 334.328 g/mol | logS: -2.13027 | SlogP: 0.331 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0853245 | Sterimol/B1: 3.58438 | Sterimol/B2: 3.82666 | Sterimol/B3: 4.81322 |
Sterimol/B4: 6.98237 | Sterimol/L: 15.5907 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 578.074 | Positive charged surface: 368.478 | Negative charged surface: 209.595 | Volume: 296.125 |
Hydrophobic surface: 355.241 | Hydrophilic surface: 222.833 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |