 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(CO)C(OC(c2ccccc2)(c2ccccc2)c2ccccc2)CC1N1C=C(C)C(=O)NC1= O |
| InChI: | InChI=1/C29H28N2O5/c1-20-18-31(28(34)30-27(20)33)26-17-24(25(19-32)35-26)36-29(21-11-5-2-6-12-21,22-13-7-3-8-14-22)23-15-9-4-10-16-23/h2-16,18,24-26,32H,17,19H2,1H3,(H,30,33,34)/t24-,25-,26+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=159.283 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 484.552 g/mol | logS: -5.94179 | SlogP: 4.2381 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.259277 | Sterimol/B1: 4.43175 | Sterimol/B2: 4.53637 | Sterimol/B3: 5.97355 | |||
| Sterimol/B4: 8.02478 | Sterimol/L: 16.7911 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 716.44 | Positive charged surface: 427.403 | Negative charged surface: 289.038 | Volume: 454.75 | |||
| Hydrophobic surface: 546.831 | Hydrophilic surface: 169.609 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules: no related molecules available.