Type: Neutral
Formula: C16H18N2O5S
SMILES: |
S(=O)(C1CC(OC1CO)N1C=C(C)C(=O)NC1=O)c1ccccc1 |
InChI: |
InChI=1/C16H18N2O5S/c1-10-8-18(16(21)17-15(10)20)14-7-13(12(9-19)23-14)24(22)11-5-3-2-4-6-11/h2-6,8,12-14,19H,7,9H2,1H3,(H,17,20,21)/t12-,13-,14-,24-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 350.395 g/mol | logS: -2.57996 | SlogP: 0.7257 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.160583 | Sterimol/B1: 2.17354 | Sterimol/B2: 4.54451 | Sterimol/B3: 5.7755 |
Sterimol/B4: 7.16139 | Sterimol/L: 14.5685 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 557.863 | Positive charged surface: 345.987 | Negative charged surface: 211.876 | Volume: 303.375 |
Hydrophobic surface: 364.061 | Hydrophilic surface: 193.802 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |