Type: Neutral
Formula: C16H18N2O4S
SMILES: |
S(C1CC(OC1CO)N1C=C(C)C(=O)NC1=O)c1ccccc1 |
InChI: |
InChI=1/C16H18N2O4S/c1-10-8-18(16(21)17-15(10)20)14-7-13(12(9-19)22-14)23-11-5-3-2-4-6-11/h2-6,8,12-14,19H,7,9H2,1H3,(H,17,20,21)/t12-,13+,14-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 334.396 g/mol | logS: -3.31119 | SlogP: 1.7102 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.085895 | Sterimol/B1: 2.55887 | Sterimol/B2: 4.53973 | Sterimol/B3: 4.68856 |
Sterimol/B4: 7.01878 | Sterimol/L: 15.7423 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 563.196 | Positive charged surface: 333.562 | Negative charged surface: 229.635 | Volume: 300.375 |
Hydrophobic surface: 367.519 | Hydrophilic surface: 195.677 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |