 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1N(C(=O)C2C1C1C(CCCCCCCCCC1)c1c2[nH]c2c1cccc2)c1ccccc1 |
| InChI: | InChI=1/C30H34N2O2/c33-29-26-22-17-11-6-4-2-1-3-5-10-16-21(22)25-23-18-12-13-19-24(23)31-28(25)27(26)30(34)32(29)20-14-8-7-9-15-20/h7-9,12-15,18-19,21-22,26-27,31H,1-6,10-11,16-17H2/t21-,22+,26-,27-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=89.466 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 454.614 g/mol | logS: -9.35616 | SlogP: 7.0691 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0803681 | Sterimol/B1: 3.17157 | Sterimol/B2: 4.29795 | Sterimol/B3: 4.35116 | |||
| Sterimol/B4: 10.798 | Sterimol/L: 17.2613 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 707.649 | Positive charged surface: 471.957 | Negative charged surface: 232.804 | Volume: 465.375 | |||
| Hydrophobic surface: 643.195 | Hydrophilic surface: 64.454 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules: no related molecules available.