Type: Neutral
Formula: C15H22N2O6
SMILES: |
O1C(CO)C(OC2OCCCC2)CC1N1C=C(C)C(=O)NC1=O |
InChI: |
InChI=1/C15H22N2O6/c1-9-7-17(15(20)16-14(9)19)12-6-10(11(8-18)22-12)23-13-4-2-3-5-21-13/h7,10-13,18H,2-6,8H2,1H3,(H,16,19,20)/t10-,11-,12+,13+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 326.349 g/mol | logS: -1.41561 | SlogP: 0.4611 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.120127 | Sterimol/B1: 3.02434 | Sterimol/B2: 4.74999 | Sterimol/B3: 5.55402 |
Sterimol/B4: 5.7632 | Sterimol/L: 15.2087 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 557.842 | Positive charged surface: 406.723 | Negative charged surface: 151.118 | Volume: 293.625 |
Hydrophobic surface: 376.83 | Hydrophilic surface: 181.012 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |