Type: Neutral
Formula: C10H15N3O5
SMILES: |
O1C(CO)C(NO)CC1N1C=C(C)C(=O)NC1=O |
InChI: |
InChI=1/C10H15N3O5/c1-5-3-13(10(16)11-9(5)15)8-2-6(12-17)7(4-14)18-8/h3,6-8,12,14,17H,2,4H2,1H3,(H,11,15,16)/t6-,7+,8+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 257.246 g/mol | logS: 0.0098 | SlogP: -1.1033 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0687473 | Sterimol/B1: 3.10107 | Sterimol/B2: 3.16241 | Sterimol/B3: 3.44526 |
Sterimol/B4: 6.34638 | Sterimol/L: 12.3825 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 455.304 | Positive charged surface: 312.298 | Negative charged surface: 143.006 | Volume: 222 |
Hydrophobic surface: 210.402 | Hydrophilic surface: 244.902 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |