Type: Neutral
Formula: C4H13N3O7P2
SMILES: |
P(O)(O)(=O)C(P(O)(O)=O)(O)CCN=C(N)N |
InChI: |
InChI=1/C4H13N3O7P2/c5-3(6)7-2-1-4(8,15(9,10)11)16(12,13)14/h8H,1-2H2,(H4,5,6,7)(H2,9,10,11)(H2,12,13,14) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 277.11 g/mol | logS: 1.31681 | SlogP: -4.489 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.156319 | Sterimol/B1: 3.49348 | Sterimol/B2: 3.55807 | Sterimol/B3: 3.79768 |
Sterimol/B4: 5.29661 | Sterimol/L: 12.407 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 422.224 | Positive charged surface: 253.009 | Negative charged surface: 169.215 | Volume: 198.25 |
Hydrophobic surface: 35.3766 | Hydrophilic surface: 386.8474 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 9 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules
|