Type: Neutral
Formula: C15H14N2O2
SMILES: |
O=C1NC(=O)C2C1CC(c1c2[nH]c2c1cccc2)C |
InChI: |
InChI=1/C15H14N2O2/c1-7-6-9-12(15(19)17-14(9)18)13-11(7)8-4-2-3-5-10(8)16-13/h2-5,7,9,12,16H,6H2,1H3,(H,17,18,19)/t7-,9-,12-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 254.289 g/mol | logS: -3.10335 | SlogP: 2.0313 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.119201 | Sterimol/B1: 2.38294 | Sterimol/B2: 2.9327 | Sterimol/B3: 4.00499 |
Sterimol/B4: 7.8967 | Sterimol/L: 11.8162 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 437.091 | Positive charged surface: 259.705 | Negative charged surface: 172.485 | Volume: 236 |
Hydrophobic surface: 281.885 | Hydrophilic surface: 155.206 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |