 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OCC1OC(C(O)C1O)c1cc(ccc1)C(=O)N)(=O)([O-])[O-] |
| InChI: | InChI=1/C12H16NO8P/c13-12(16)7-3-1-2-6(4-7)11-10(15)9(14)8(21-11)5-20-22(17,18)19/h1-4,8-11,14-15H,5H2,(H2,13,16)(H2,17,18,19)/p-2/t8-,9+,10+,11+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=57.5954 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 331.217 g/mol | logS: -1.22504 | SlogP: -3.1822 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0674162 | Sterimol/B1: 3.16129 | Sterimol/B2: 3.25325 | Sterimol/B3: 3.4244 | |||
| Sterimol/B4: 6.53555 | Sterimol/L: 15.1914 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 506.718 | Positive charged surface: 254.732 | Negative charged surface: 251.985 | Volume: 264 | |||
| Hydrophobic surface: 191.835 | Hydrophilic surface: 314.883 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 3 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
