Type: Neutral
Formula: C10H15N3O6
SMILES: |
O1C(C(O)CO)C(O)C(O)C1N1C=CC(=NC1=O)N |
InChI: |
InChI=1/C10H15N3O6/c11-5-1-2-13(10(18)12-5)9-7(17)6(16)8(19-9)4(15)3-14/h1-2,4,6-9,14-17H,3H2,(H2,11,12,18)/t4-,6+,7+,8+,9-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 273.245 g/mol | logS: 0.13013 | SlogP: -2.9072 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.101426 | Sterimol/B1: 3.12008 | Sterimol/B2: 3.14403 | Sterimol/B3: 3.81061 |
Sterimol/B4: 6.115 | Sterimol/L: 12.9719 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 449.79 | Positive charged surface: 320.486 | Negative charged surface: 129.305 | Volume: 227.25 |
Hydrophobic surface: 155.071 | Hydrophilic surface: 294.719 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |