Type: Neutral
Formula: C11H13N5O3S
SMILES: |
S=C1NC(=Nc2n(cnc12)C1C=C(CO)C(O)C1O)N |
InChI: |
InChI=1/C11H13N5O3S/c12-11-14-9-6(10(20)15-11)13-3-16(9)5-1-4(2-17)7(18)8(5)19/h1,3,5,7-8,17-19H,2H2,(H3,12,14,15,20)/t5-,7-,8-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 295.323 g/mol | logS: -2.41098 | SlogP: -1.6013 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.148387 | Sterimol/B1: 3.33212 | Sterimol/B2: 3.96771 | Sterimol/B3: 4.67952 |
Sterimol/B4: 6.13397 | Sterimol/L: 13.3634 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 496.395 | Positive charged surface: 331.188 | Negative charged surface: 165.206 | Volume: 246.625 |
Hydrophobic surface: 140.842 | Hydrophilic surface: 355.553 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |