Type: Neutral
Formula: C10H14N2O7
SMILES: |
O1C(C(O)CO)C(O)C(O)C1N1C=CC(=O)NC1=O |
InChI: |
InChI=1/C10H14N2O7/c13-3-4(14)8-6(16)7(17)9(19-8)12-2-1-5(15)11-10(12)18/h1-2,4,6-9,13-14,16-17H,3H2,(H,11,15,18)/t4-,6+,7-,8+,9+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 274.229 g/mol | logS: 0.33089 | SlogP: -3.1482 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.1228 | Sterimol/B1: 2.46158 | Sterimol/B2: 2.82803 | Sterimol/B3: 3.99299 |
Sterimol/B4: 6.2488 | Sterimol/L: 13.1263 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 435.227 | Positive charged surface: 295.063 | Negative charged surface: 140.164 | Volume: 221.5 |
Hydrophobic surface: 177.471 | Hydrophilic surface: 257.756 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |