Type: Neutral
Formula: C10H15FN2O6
SMILES: |
FC1C(OC)N(C2OC(CO)C(O)C2)C(=O)NC1=O |
InChI: |
InChI=1/C10H15FN2O6/c1-18-9-7(11)8(16)12-10(17)13(9)6-2-4(15)5(3-14)19-6/h4-7,9,14-15H,2-3H2,1H3,(H,12,16,17)/t4-,5-,6-,7+,9-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 278.236 g/mol | logS: -0.35045 | SlogP: -1.2631 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.208335 | Sterimol/B1: 2.3258 | Sterimol/B2: 2.50082 | Sterimol/B3: 4.89974 |
Sterimol/B4: 6.63978 | Sterimol/L: 12.3179 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 448.861 | Positive charged surface: 319.418 | Negative charged surface: 129.443 | Volume: 227.75 |
Hydrophobic surface: 209.29 | Hydrophilic surface: 239.571 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |