 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(C(=O)C)c1ccc(cc1)CC([NH3+])C(=O)NNC(=O)C(NC(OCc1ccccc1)=O) C(C)C |
| InChI: | InChI=1/C24H30N4O6/c1-15(2)21(26-24(32)33-14-18-7-5-4-6-8-18)23(31)28-27-22(30)20(25)13-17-9-11-19(12-10-17)34-16(3)29/h4-12,15,20-21H,13-14,25H2,1-3H3,(H,26,32)(H,27,30)(H,28,31)/p+1/t20-,21-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=79.7353 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 471.534 g/mol | logS: -4.6455 | SlogP: 1.12967 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0502521 | Sterimol/B1: 2.22078 | Sterimol/B2: 3.80757 | Sterimol/B3: 7.29904 | |||
| Sterimol/B4: 8.67139 | Sterimol/L: 24.0528 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 849.766 | Positive charged surface: 532.317 | Negative charged surface: 317.449 | Volume: 458.25 | |||
| Hydrophobic surface: 582.724 | Hydrophilic surface: 267.042 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
