Type: Neutral
Formula: C10H13N5O4
SMILES: |
O1C(C)C(O)C(O)C1n1c2N=C(NC(=O)c2nc1)N |
InChI: |
InChI=1/C10H13N5O4/c1-3-5(16)6(17)9(19-3)15-2-12-4-7(15)13-10(11)14-8(4)18/h2-3,5-6,9,16-17H,1H3,(H3,11,13,14,18)/t3-,5-,6-,9+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 267.245 g/mol | logS: -1.19541 | SlogP: -1.6927 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0954857 | Sterimol/B1: 2.66901 | Sterimol/B2: 4.03764 | Sterimol/B3: 4.2904 |
Sterimol/B4: 4.41997 | Sterimol/L: 13.0472 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 443.801 | Positive charged surface: 318.455 | Negative charged surface: 125.346 | Volume: 221.875 |
Hydrophobic surface: 151.216 | Hydrophilic surface: 292.585 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |