Type: Neutral
Formula: C10H13N5O6
SMILES: |
OC1C(O)C(NC=2N=C(NC(=O)C=2[N+](=O)[O-])N)C=C1CO |
InChI: |
InChI=1/C10H13N5O6/c11-10-13-8(5(15(20)21)9(19)14-10)12-4-1-3(2-16)6(17)7(4)18/h1,4,6-7,16-18H,2H2,(H4,11,12,13,14,19)/t4-,6+,7-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 299.243 g/mol | logS: -1.6184 | SlogP: -3.511 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.144104 | Sterimol/B1: 3.71226 | Sterimol/B2: 3.82741 | Sterimol/B3: 4.14458 |
Sterimol/B4: 5.50931 | Sterimol/L: 12.8418 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 482.619 | Positive charged surface: 321.338 | Negative charged surface: 161.281 | Volume: 235.375 |
Hydrophobic surface: 96.4807 | Hydrophilic surface: 386.1383 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 0 | Violations of Lipinski's rule: 2 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |