 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(Nc1ccccc1)C1C(C(C(=O)Nc2ccccc2)=C(N=C1C)C)c1ccc(NC(=O)C) cc1 |
| InChI: | InChI=1/C29H28N4O3/c1-18-25(28(35)32-22-10-6-4-7-11-22)27(21-14-16-24(17-15-21)31-20(3)34)26(19(2)30-18)29(36)33-23-12-8-5-9-13-23/h4-17,25,27H,1-3H3,(H,31,34)(H,32,35)(H,33,36)/t25-,27-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=183.057 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 480.568 g/mol | logS: -6.4239 | SlogP: 5.3707 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.221015 | Sterimol/B1: 3.0343 | Sterimol/B2: 3.09724 | Sterimol/B3: 7.70871 | |||
| Sterimol/B4: 10.9045 | Sterimol/L: 18.494 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 774.9 | Positive charged surface: 466.578 | Negative charged surface: 308.322 | Volume: 462.125 | |||
| Hydrophobic surface: 685.777 | Hydrophilic surface: 89.123 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules
