 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(Nc1cc2c(cc1)cccc2)C1N(CCC1)C(=O)C(NC(=O)C([NH3+])C)Cc1cc ccc1 |
| InChI: | InChI=1/C27H30N4O3/c1-18(28)25(32)30-23(16-19-8-3-2-4-9-19)27(34)31-15-7-12-24(31)26(33)29-22-14-13-20-10-5-6-11-21(20)17-22/h2-6,8-11,13-14,17-18,23-24H,7,12,15-16,28H2,1H3,(H,29,33)(H,30,32)/p+1/t18-,23-,24-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=110.756 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 459.57 g/mol | logS: -6.07993 | SlogP: 2.12717 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.126912 | Sterimol/B1: 2.59272 | Sterimol/B2: 2.89347 | Sterimol/B3: 6.07041 | |||
| Sterimol/B4: 10.8612 | Sterimol/L: 19.3466 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 779.439 | Positive charged surface: 502.354 | Negative charged surface: 266.586 | Volume: 458 | |||
| Hydrophobic surface: 624.633 | Hydrophilic surface: 154.806 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
