 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC(=O)C(NC(=O)C(NC(=O)C)Cc1ccccc1)CCCNC(N)=N |
| InChI: | InChI=1/C17H25N5O4/c1-11(23)21-14(10-12-6-3-2-4-7-12)15(24)22-13(16(25)26)8-5-9-20-17(18)19/h2-4,6-7,13-14H,5,8-10H2,1H3,(H,21,23)(H,22,24)(H,25,26)(H4,18,19,20)/t13-,14-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=34.338 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 363.418 g/mol | logS: -2.49233 | SlogP: -0.43356 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.135307 | Sterimol/B1: 3.76242 | Sterimol/B2: 3.81354 | Sterimol/B3: 5.25396 | |||
| Sterimol/B4: 7.67152 | Sterimol/L: 17.3009 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 645.536 | Positive charged surface: 422.332 | Negative charged surface: 223.204 | Volume: 343.25 | |||
| Hydrophobic surface: 359.801 | Hydrophilic surface: 285.735 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 7 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules: no related molecules available.