 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(Cc1ccccc1)C(=O)NC(CC(C)C)C(=O)NC(Cc1c2c([nH]c1)cccc2)C(=O) [O-] |
| InChI: | InChI=1/C25H29N3O5/c1-16(2)12-21(28-25(32)33-15-17-8-4-3-5-9-17)23(29)27-22(24(30)31)13-18-14-26-20-11-7-6-10-19(18)20/h3-11,14,16,21-22,26H,12-13,15H2,1-2H3,(H,27,29)(H,28,32)(H,30,31)/p-1/t21-,22-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=51.6305 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 450.515 g/mol | logS: -5.71538 | SlogP: 2.55257 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.115044 | Sterimol/B1: 2.83186 | Sterimol/B2: 3.30208 | Sterimol/B3: 4.99827 | |||
| Sterimol/B4: 9.25381 | Sterimol/L: 17.2748 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 701.792 | Positive charged surface: 419.798 | Negative charged surface: 279.068 | Volume: 438.375 | |||
| Hydrophobic surface: 492.776 | Hydrophilic surface: 209.016 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 2 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
