 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Oc1ccc(cc1)CC(NC(=O)C([NH3+])C)C(=O)NC(Cc1ccccc1)C(=O)N |
| InChI: | InChI=1/C21H26N4O4/c1-13(22)20(28)25-18(12-15-7-9-16(26)10-8-15)21(29)24-17(19(23)27)11-14-5-3-2-4-6-14/h2-10,13,17-18,26H,11-12,22H2,1H3,(H2,23,27)(H,24,29)(H,25,28)/p+1/t13-,17-,18-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=77.681 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 399.471 g/mol | logS: -3.50521 | SlogP: -0.73736 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.206636 | Sterimol/B1: 3.01241 | Sterimol/B2: 4.41158 | Sterimol/B3: 6.95645 | |||
| Sterimol/B4: 7.22845 | Sterimol/L: 14.0866 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 679.177 | Positive charged surface: 444.467 | Negative charged surface: 234.709 | Volume: 389.75 | |||
| Hydrophobic surface: 416.238 | Hydrophilic surface: 262.939 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
