 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(Cc1ccccc1)C(=O)NC(C(CC)C)C(=O)NC(Cc1c2c([nH]c1)cccc2)C(=O) [O-] |
| InChI: | InChI=1/C25H29N3O5/c1-3-16(2)22(28-25(32)33-15-17-9-5-4-6-10-17)23(29)27-21(24(30)31)13-18-14-26-20-12-8-7-11-19(18)20/h4-12,14,16,21-22,26H,3,13,15H2,1-2H3,(H,27,29)(H,28,32)(H,30,31)/p-1/t16-,21+,22+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=52.3493 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 450.515 g/mol | logS: -5.40193 | SlogP: 2.55257 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.158475 | Sterimol/B1: 2.48461 | Sterimol/B2: 2.96608 | Sterimol/B3: 5.94772 | |||
| Sterimol/B4: 10.0047 | Sterimol/L: 17.6476 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 707.823 | Positive charged surface: 421.579 | Negative charged surface: 283.011 | Volume: 440.75 | |||
| Hydrophobic surface: 505.405 | Hydrophilic surface: 202.418 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 2 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
