 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(C(OC(=O)C)C2(C3C4(C(C=CC3OC(=O)C)C(OC4)=O)CCC2C1=O)C)c1c coc1 |
| InChI: | InChI=1/C24H26O9/c1-12(25)31-17-5-4-16-21(27)30-11-24(16)8-6-15-22(28)33-18(14-7-9-29-10-14)20(32-13(2)26)23(15,3)19(17)24/h4-5,7,9-10,15-20H,6,8,11H2,1-3H3/t15-,16-,17+,18+,19-,20-,23-,24+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=162.194 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 458.463 g/mol | logS: -3.92749 | SlogP: 2.5981 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.401172 | Sterimol/B1: 2.48889 | Sterimol/B2: 2.95077 | Sterimol/B3: 6.7029 | |||
| Sterimol/B4: 10.1018 | Sterimol/L: 13.8766 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 587.734 | Positive charged surface: 327.009 | Negative charged surface: 260.725 | Volume: 395.5 | |||
| Hydrophobic surface: 399.593 | Hydrophilic surface: 188.141 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 0 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 8 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules: no related molecules available.