Type: Neutral
Formula: C14H20N2O9
SMILES: |
O1C(CO)C(O)C(O)C(O)C1OC1(C#N)C(OC)=CC(=O)N(C)C1O |
InChI: |
InChI=1/C14H20N2O9/c1-16-8(18)3-7(23-2)14(5-15,13(16)22)25-12-11(21)10(20)9(19)6(4-17)24-12/h3,6,9-13,17,19-22H,4H2,1-2H3/t6-,9+,10+,11+,12+,13-,14-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 360.319 g/mol | logS: 0.04156 | SlogP: -3.61402 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.272737 | Sterimol/B1: 2.55013 | Sterimol/B2: 4.31788 | Sterimol/B3: 4.68933 |
Sterimol/B4: 7.46466 | Sterimol/L: 12.9688 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 546.151 | Positive charged surface: 417.924 | Negative charged surface: 128.227 | Volume: 302 |
Hydrophobic surface: 282.53 | Hydrophilic surface: 263.621 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 10 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 7 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |