Type: Neutral
Formula: C13H14N6O5
SMILES: |
O1C(CO)C(O)C(O)C1n1cc(c2-c3n(ncn3)C=Nc12)C(=O)N |
InChI: |
InChI=1/C13H14N6O5/c14-10(23)5-1-18(13-9(22)8(21)6(2-20)24-13)11-7(5)12-15-3-17-19(12)4-16-11/h1,3-4,6,8-9,13,20-22H,2H2,(H2,14,23)/t6-,8+,9+,13-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 334.292 g/mol | logS: -1.58497 | SlogP: -1.926 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0799006 | Sterimol/B1: 3.5144 | Sterimol/B2: 4.22867 | Sterimol/B3: 4.88802 |
Sterimol/B4: 6.12012 | Sterimol/L: 15.3258 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 523.553 | Positive charged surface: 382.542 | Negative charged surface: 141.011 | Volume: 275.125 |
Hydrophobic surface: 176.97 | Hydrophilic surface: 346.583 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |