 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(C)C(O)C([NH3+])CC1OC1CC(O)(C(=O)C)C(N=[N+]=[N-])c2c1c(O) c1c(C(=O)c3c(C1=O)c(OC)ccc3)c2O |
| InChI: | InChI=1/C27H28N4O10/c1-9-21(33)12(28)7-15(40-9)41-14-8-27(38,10(2)32)26(30-31-29)20-17(14)24(36)19-18(25(20)37)22(34)11-5-4-6-13(39-3)16(11)23(19)35/h4-6,9,12,14-15,21,26,33,36-38H,7-8,28H2,1-3H3/p+1/t9-,12-,14+,15+,21-,26-,27+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=110.977 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 569.547 g/mol | logS: -4.11976 | SlogP: 1.312 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.0565652 | Sterimol/B1: 4.49217 | Sterimol/B2: 5.06098 | Sterimol/B3: 6.30758 | |||
| Sterimol/B4: 7.83439 | Sterimol/L: 18.3628 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 801.828 | Positive charged surface: 541.046 | Negative charged surface: 260.782 | Volume: 488.625 | |||
| Hydrophobic surface: 458.437 | Hydrophilic surface: 343.391 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 12 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 7 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 0 | Violations of Lipinski's rule: 2 | Oprea's lead like rule: 0 | ||||
|
