Type: Neutral
Formula: C10H13FN2O5
SMILES: |
FC1=CN(C2CC(CO)C(O)C2O)C(=O)NC1=O |
InChI: |
InChI=1/C10H13FN2O5/c11-5-2-13(10(18)12-9(5)17)6-1-4(3-14)7(15)8(6)16/h2,4,6-8,14-16H,1,3H2,(H,12,17,18)/t4-,6+,7+,8-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 260.221 g/mol | logS: -0.51562 | SlogP: -1.4394 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.151057 | Sterimol/B1: 2.416 | Sterimol/B2: 3.79128 | Sterimol/B3: 4.11729 |
Sterimol/B4: 4.17609 | Sterimol/L: 13.2511 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 423.763 | Positive charged surface: 275.9 | Negative charged surface: 147.863 | Volume: 208 |
Hydrophobic surface: 195.1 | Hydrophilic surface: 228.663 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |