 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(CO)C(O)C(O)C1n1c2ncnc(NCN3CCN(CC3)c3ccccc3)c2nc1 |
| InChI: | InChI=1/C21H27N7O4/c29-10-15-17(30)18(31)21(32-15)28-13-24-16-19(22-11-23-20(16)28)25-12-26-6-8-27(9-7-26)14-4-2-1-3-5-14/h1-5,11,13,15,17-18,21,29-31H,6-10,12H2,(H,22,23,25)/t15-,17+,18-,21+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=203.617 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 441.492 g/mol | logS: -2.51224 | SlogP: -0.2751 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0656552 | Sterimol/B1: 2.20091 | Sterimol/B2: 4.23622 | Sterimol/B3: 4.49677 | |||
| Sterimol/B4: 7.11501 | Sterimol/L: 20.615 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 709.226 | Positive charged surface: 540.354 | Negative charged surface: 168.872 | Volume: 403.125 | |||
| Hydrophobic surface: 456.265 | Hydrophilic surface: 252.961 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules: no related molecules available.