Type: Neutral
Formula: C10H13N5O5
SMILES: |
O1C(CO)C(O)C(O)C1n1ncc2c1N=C(NC2=O)N |
InChI: |
InChI=1/C10H13N5O5/c11-10-13-7-3(8(19)14-10)1-12-15(7)9-6(18)5(17)4(2-16)20-9/h1,4-6,9,16-18H,2H2,(H3,11,13,14,19)/t4-,5+,6+,9-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 283.244 g/mol | logS: -0.34456 | SlogP: -2.7203 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.118324 | Sterimol/B1: 2.54317 | Sterimol/B2: 4.03472 | Sterimol/B3: 4.34897 |
Sterimol/B4: 6.76537 | Sterimol/L: 13.3021 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 475.407 | Positive charged surface: 347.892 | Negative charged surface: 127.516 | Volume: 228 |
Hydrophobic surface: 165.25 | Hydrophilic surface: 310.157 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |