Type: Neutral
Formula: C11H16ClN3O7
SMILES: |
ClC=1C(=O)NC(OC)=NC=1NC1OC(CO)C(O)C(O)C1O |
InChI: |
InChI=1/C11H16ClN3O7/c1-21-11-14-8(4(12)9(20)15-11)13-10-7(19)6(18)5(17)3(2-16)22-10/h3,5-7,10,16-19H,2H2,1H3,(H2,13,14,15,20)/t3-,5+,6+,7-,10+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 337.716 g/mol | logS: -1.058 | SlogP: -2.9751 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.271153 | Sterimol/B1: 2.1733 | Sterimol/B2: 4.18108 | Sterimol/B3: 5.67088 |
Sterimol/B4: 7.26165 | Sterimol/L: 12.3306 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 518.928 | Positive charged surface: 356.49 | Negative charged surface: 162.438 | Volume: 267.25 |
Hydrophobic surface: 237.679 | Hydrophilic surface: 281.249 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |