Type: Neutral
Formula: C11H16ClN3O7
SMILES: |
ClC=1C(=O)NC(OC)=NC=1NC1OC(CO)C(O)C(O)C1O |
InChI: |
InChI=1/C11H16ClN3O7/c1-21-11-14-8(4(12)9(20)15-11)13-10-7(19)6(18)5(17)3(2-16)22-10/h3,5-7,10,16-19H,2H2,1H3,(H2,13,14,15,20)/t3-,5+,6+,7-,10-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 337.716 g/mol | logS: -1.058 | SlogP: -2.9751 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.214027 | Sterimol/B1: 2.10844 | Sterimol/B2: 2.67703 | Sterimol/B3: 6.19081 |
Sterimol/B4: 7.12484 | Sterimol/L: 12.735 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 522.99 | Positive charged surface: 355.408 | Negative charged surface: 167.582 | Volume: 266.375 |
Hydrophobic surface: 239.211 | Hydrophilic surface: 283.779 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |