Type: Neutral
Formula: C10H13N5O4
SMILES: |
O1C(CO)C(N)C(O)C1n1c2NC=NC(=O)c2nc1 |
InChI: |
InChI=1/C10H13N5O4/c11-5-4(1-16)19-10(7(5)17)15-3-14-6-8(15)12-2-13-9(6)18/h2-5,7,10,16-17H,1,11H2,(H,12,13,18)/t4-,5+,7+,10+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 267.245 g/mol | logS: -0.50863 | SlogP: -1.8495 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0710712 | Sterimol/B1: 2.96337 | Sterimol/B2: 3.61925 | Sterimol/B3: 3.62163 |
Sterimol/B4: 4.98657 | Sterimol/L: 12.6678 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 432.966 | Positive charged surface: 298.324 | Negative charged surface: 134.642 | Volume: 220.5 |
Hydrophobic surface: 148.997 | Hydrophilic surface: 283.969 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |