Type: Ionized
Formula: C8H12N2O8-2
SMILES: |
O1CC(O)C(O)C([O-])C1(O)CN(N=O)CC(=O)[O-] |
InChI: |
InChI=1/C8H13N2O8/c11-4-2-18-8(16,7(15)6(4)14)3-10(9-17)1-5(12)13/h4,6-7,11,14,16H,1-3H2,(H,12,13)/q-1/p-1/t4-,6+,7+,8+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 264.19 g/mol | logS: 0.34408 | SlogP: -4.0406 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.123743 | Sterimol/B1: 2.18319 | Sterimol/B2: 2.64592 | Sterimol/B3: 4.18869 |
Sterimol/B4: 5.689 | Sterimol/L: 13.3369 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 420.399 | Positive charged surface: 216.575 | Negative charged surface: 203.825 | Volume: 201.25 |
Hydrophobic surface: 204.064 | Hydrophilic surface: 216.335 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 3 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
|
|
|
Parent related molecule:
|