Type: Neutral
Formula: C13H19N2O7PS
| SMILES: |
s1cc(nc1C1OC(C2OC(OC12)(C)C)CCP(O)(O)=O)C(=O)N |
| InChI: |
InChI=1/C13H19N2O7PS/c1-13(2)21-8-7(3-4-23(17,18)19)20-10(9(8)22-13)12-15-6(5-24-12)11(14)16/h5,7-10H,3-4H2,1-2H3,(H2,14,16)(H2,17,18,19)/t7-,8-,9-,10+/m1/s1 |
MOE's Descriptors
| Physical Properties | | | |
| Molecular Weight: 378.342 g/mol | logS: -1.43316 | SlogP: -0.2049 | Reactive groups: 0 |
| | | | |
| Topological Properties | | | |
| Globularity: 0.135818 | Sterimol/B1: 2.47011 | Sterimol/B2: 2.73915 | Sterimol/B3: 4.8582 |
| Sterimol/B4: 10.049 | Sterimol/L: 14.9528 | | | |
| | | | |
| Surface and Volume Properties | | | |
| Accessible surface: 595.72 | Positive charged surface: 358.774 | Negative charged surface: 236.946 | Volume: 306.875 |
| Hydrophobic surface: 280.939 | Hydrophilic surface: 314.781 | | |
| | | | |
| Pharmacophoric Properties | | | |
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
| Chiral centers: 4 | | | |
| | | | |
| Drug- and Lead-like Properties | | | |
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
| |
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |