Type: Neutral
Formula: C14H18N3O6P
SMILES: |
P1(OC2CC(OC2CO1)N1C=C(C)C(=O)NC1=O)(=O)C(C#N)(C)C |
InChI: |
InChI=1/C14H18N3O6P/c1-8-5-17(13(19)16-12(8)18)11-4-9-10(22-11)6-21-24(20,23-9)14(2,3)7-15/h5,9-11H,4,6H2,1-3H3,(H,16,18,19)/t9-,10+,11-,24-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 355.287 g/mol | logS: -1.89946 | SlogP: 0.397484 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0846279 | Sterimol/B1: 3.28137 | Sterimol/B2: 4.33873 | Sterimol/B3: 4.66634 |
Sterimol/B4: 4.67012 | Sterimol/L: 15.9958 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 549.897 | Positive charged surface: 335.353 | Negative charged surface: 214.545 | Volume: 298.375 |
Hydrophobic surface: 313.496 | Hydrophilic surface: 236.401 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |