 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(CO)C(O)CC1n1c2nc(nc(OC)c2nc1)Nc1ccc(cc1)CCCC |
| InChI: | InChI=1/C21H27N5O4/c1-3-4-5-13-6-8-14(9-7-13)23-21-24-19-18(20(25-21)29-2)22-12-26(19)17-10-15(28)16(11-27)30-17/h6-9,12,15-17,27-28H,3-5,10-11H2,1-2H3,(H,23,24,25)/t15-,16-,17+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=101.388 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 413.478 g/mol | logS: -5.93813 | SlogP: 2.65727 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.028224 | Sterimol/B1: 2.44102 | Sterimol/B2: 3.5189 | Sterimol/B3: 4.60703 | |||
| Sterimol/B4: 6.70846 | Sterimol/L: 22.5715 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 708.305 | Positive charged surface: 539.006 | Negative charged surface: 169.299 | Volume: 391.75 | |||
| Hydrophobic surface: 489.593 | Hydrophilic surface: 218.712 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.