Type: Neutral
Formula: C12H17N3O5
| SMILES: |
O1C(CO)C(O)C(O)C1N1C=CC(=NC1=O)NC1CC1 |
| InChI: |
InChI=1/C12H17N3O5/c16-5-7-9(17)10(18)11(20-7)15-4-3-8(14-12(15)19)13-6-1-2-6/h3-4,6-7,9-11,16-18H,1-2,5H2,(H,13,14,19)/t7-,9+,10+,11+/m0/s1 |
MOE's Descriptors
| Physical Properties | | | |
| Molecular Weight: 283.284 g/mol | logS: -0.5188 | SlogP: -1.4748 | Reactive groups: 0 |
| | | | |
| Topological Properties | | | |
| Globularity: 0.0556768 | Sterimol/B1: 3.19276 | Sterimol/B2: 3.27572 | Sterimol/B3: 3.68522 |
| Sterimol/B4: 5.92935 | Sterimol/L: 14.3782 | | | |
| | | | |
| Surface and Volume Properties | | | |
| Accessible surface: 497.592 | Positive charged surface: 336.553 | Negative charged surface: 161.039 | Volume: 249.625 |
| Hydrophobic surface: 240.307 | Hydrophilic surface: 257.285 | | |
| | | | |
| Pharmacophoric Properties | | | |
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
| Chiral centers: 4 | | | |
| | | | |
| Drug- and Lead-like Properties | | | |
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
| |
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |