Type: Neutral
Formula: C12H16N4O4S
SMILES: |
S(CC)C1C(O)C(OC1n1c2NC=NC(=O)c2nc1)CO |
InChI: |
InChI=1/C12H16N4O4S/c1-2-21-9-8(18)6(3-17)20-12(9)16-5-15-7-10(16)13-4-14-11(7)19/h4-6,8-9,12,17-18H,2-3H2,1H3,(H,13,14,19)/t6-,8-,9+,12-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 312.35 g/mol | logS: -2.13636 | SlogP: -0.0551 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.209779 | Sterimol/B1: 2.43335 | Sterimol/B2: 3.19878 | Sterimol/B3: 4.64518 |
Sterimol/B4: 8.81538 | Sterimol/L: 13.0922 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 515.802 | Positive charged surface: 361.863 | Negative charged surface: 153.94 | Volume: 268.375 |
Hydrophobic surface: 241.534 | Hydrophilic surface: 274.268 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |