Type: Neutral
Formula: C13H19N3O3
SMILES: |
OC(C(N)C(=O)NC(Cc1ccccc1)C(=O)N)C |
InChI: |
InChI=1/C13H19N3O3/c1-8(17)11(14)13(19)16-10(12(15)18)7-9-5-3-2-4-6-9/h2-6,8,10-11,17H,7,14H2,1H3,(H2,15,18)(H,16,19)/t8-,10-,11-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 265.313 g/mol | logS: -1.68707 | SlogP: -1.09273 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.138882 | Sterimol/B1: 2.83333 | Sterimol/B2: 4.33483 | Sterimol/B3: 4.34402 |
Sterimol/B4: 7.00998 | Sterimol/L: 13.1354 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 491.17 | Positive charged surface: 310.581 | Negative charged surface: 180.589 | Volume: 256.75 |
Hydrophobic surface: 275.545 | Hydrophilic surface: 215.625 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |