Type: Neutral
Formula: C12H23ClN2O6
SMILES: |
ClCCNC(=O)NC(C(OC)C(OC)C(O)COC)C=O |
InChI: |
InChI=1/C12H23ClN2O6/c1-19-7-9(17)11(21-3)10(20-2)8(6-16)15-12(18)14-5-4-13/h6,8-11,17H,4-5,7H2,1-3H3,(H2,14,15,18)/t8-,9+,10-,11-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 326.777 g/mol | logS: -0.62754 | SlogP: -0.8708 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.0937462 | Sterimol/B1: 2.23889 | Sterimol/B2: 2.53762 | Sterimol/B3: 5.00726 |
Sterimol/B4: 8.60537 | Sterimol/L: 16.6009 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 578.352 | Positive charged surface: 428.178 | Negative charged surface: 150.174 | Volume: 297.125 |
Hydrophobic surface: 363.97 | Hydrophilic surface: 214.382 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |