Type: Neutral
Formula: C10H13FN2O6
SMILES: |
FC1(CO)C(O)C(OC1CO)N1C=CC(=O)NC1=O |
InChI: |
InChI=1/C10H13FN2O6/c11-10(4-15)5(3-14)19-8(7(10)17)13-2-1-6(16)12-9(13)18/h1-2,5,7-8,14-15,17H,3-4H2,(H,12,16,18)/t5-,7+,8+,10-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 276.22 g/mol | logS: -0.19534 | SlogP: -1.7495 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.100778 | Sterimol/B1: 2.79391 | Sterimol/B2: 3.04445 | Sterimol/B3: 3.96477 |
Sterimol/B4: 5.6546 | Sterimol/L: 12.6092 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 425.565 | Positive charged surface: 263.965 | Negative charged surface: 161.6 | Volume: 214.25 |
Hydrophobic surface: 154.625 | Hydrophilic surface: 270.94 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |